C20H14F6N4O3 — CID 141470240
(2S,5R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-N-(4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carboxamide (PubChem CID 141470240) has the molecular formula C20H14F6N4O3 and a molecular weight of 472.35 g/mol. Its IUPAC name is (2S,5R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-N-(4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,5R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-N-(4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 141470240 |
| Molecular Formula | C20H14F6N4O3 |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (2S,5R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-N-(4-nitrophenyl)-5-(trifluoromethyl)pyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(C2C[C@@H](C(=O)Nc3ccc([N+](=O)[O-])cc3)N[C@H]2C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H14F6N4O3/c21-19(22,23)15-7-10(1-2-11(15)9-27)14-8-16(29-17(14)20(24,25)26)18(31)28-12-3-5-13(6-4-12)30(32)33/h1-7,14,16-17,29H,8H2,(H,28,31)/t14?,16-,17+/m0/s1 |
| InChIKey | SXMLKFZJETUDLP-MWSTZMHHSA-N |
| XLogP | 4.50 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|