C26H31NO2S — CID 141472327
N,N-bis[4-(2-methylpropyl)phenyl]benzenesulfonamide (PubChem CID 141472327) has the molecular formula C26H31NO2S and a molecular weight of 421.61 g/mol. Its IUPAC name is N,N-bis[4-(2-methylpropyl)phenyl]benzenesulfonamide.
| Compound Name | N,N-bis[4-(2-methylpropyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141472327 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N,N-bis[4-(2-methylpropyl)phenyl]benzenesulfonamide |
| SMILES | CC(C)Cc1ccc(N(c2ccc(CC(C)C)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO2S/c1-20(2)18-22-10-14-24(15-11-22)27(30(28,29)26-8-6-5-7-9-26)25-16-12-23(13-17-25)19-21(3)4/h5-17,20-21H,18-19H2,1-4H3 |
| InChIKey | QFQIPMXWQQDEHH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |