C15H13N3O4 — CID 141472511
2-amino-1-(2-nitrophenyl)-7,8-dihydro-6H-quinoline-4,5-dione (PubChem CID 141472511) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-amino-1-(2-nitrophenyl)-7,8-dihydro-6H-quinoline-4,5-dione.
| Compound Name | 2-amino-1-(2-nitrophenyl)-7,8-dihydro-6H-quinoline-4,5-dione |
|---|---|
| PubChem CID | 141472511 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-amino-1-(2-nitrophenyl)-7,8-dihydro-6H-quinoline-4,5-dione |
| SMILES | Nc1cc(=O)c2c(n1-c1ccccc1[N+](=O)[O-])CCCC2=O |
| InChI | InChI=1S/C15H13N3O4/c16-14-8-13(20)15-11(6-3-7-12(15)19)17(14)9-4-1-2-5-10(9)18(21)22/h1-2,4-5,8H,3,6-7,16H2 |
| InChIKey | RXNFYCCZOKXPNV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|