C18H13N3O4 — CID 117071566
5-(2-nitrobenzoyl)-7,8-dihydro-6H-pyrido[3,2-b]indol-9-one (PubChem CID 117071566) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 5-(2-nitrobenzoyl)-7,8-dihydro-6H-pyrido[3,2-b]indol-9-one.
| Compound Name | 5-(2-nitrobenzoyl)-7,8-dihydro-6H-pyrido[3,2-b]indol-9-one |
|---|---|
| PubChem CID | 117071566 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-(2-nitrobenzoyl)-7,8-dihydro-6H-pyrido[3,2-b]indol-9-one |
| SMILES | O=C1CCCc2c1c1ncccc1n2C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13N3O4/c22-15-9-3-7-13-16(15)17-14(8-4-10-19-17)20(13)18(23)11-5-1-2-6-12(11)21(24)25/h1-2,4-6,8,10H,3,7,9H2 |
| InChIKey | SGRNRWWREVGDJV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|