C9H6N4O4S — CID 10754201
5-amino-2-(2-nitrobenzoyl)-1,2,4-thiadiazol-3-one (PubChem CID 10754201) has the molecular formula C9H6N4O4S and a molecular weight of 266.24 g/mol. Its IUPAC name is 5-amino-2-(2-nitrobenzoyl)-1,2,4-thiadiazol-3-one.
| Compound Name | 5-amino-2-(2-nitrobenzoyl)-1,2,4-thiadiazol-3-one |
|---|---|
| PubChem CID | 10754201 |
| Molecular Formula | C9H6N4O4S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-amino-2-(2-nitrobenzoyl)-1,2,4-thiadiazol-3-one |
| SMILES | Nc1nc(=O)n(C(=O)c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H6N4O4S/c10-8-11-9(15)12(18-8)7(14)5-3-1-2-4-6(5)13(16)17/h1-4H,(H2,10,11,15) |
| InChIKey | RHCMTTDXYAVGDV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|