C29H25NO2 — CID 141473406
methyl (E)-3-[4-[(E)-3,4-dihydro-2H-naphthalen-1-ylidene(1H-indol-5-yl)methyl]phenyl]prop-2-enoate (PubChem CID 141473406) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl (E)-3-[4-[(E)-3,4-dihydro-2H-naphthalen-1-ylidene(1H-indol-5-yl)methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(E)-3,4-dihydro-2H-naphthalen-1-ylidene(1H-indol-5-yl)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 141473406 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl (E)-3-[4-[(E)-3,4-dihydro-2H-naphthalen-1-ylidene(1H-indol-5-yl)methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(/C(=C2/CCCc3ccccc32)c2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C29H25NO2/c1-32-28(31)16-11-20-9-12-22(13-10-20)29(24-14-15-27-23(19-24)17-18-30-27)26-8-4-6-21-5-2-3-7-25(21)26/h2-3,5,7,9-19,30H,4,6,8H2,1H3/b16-11+,29-26+ |
| InChIKey | VFQXJBVNCBLPHX-UCQOKUEESA-N |
| XLogP | 6.65 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|