C14H22N2 — CID 14147486
N,N-diethyl-6,7,8,9-tetrahydro-1H-3-benzazepin-2-amine (PubChem CID 14147486) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N,N-diethyl-6,7,8,9-tetrahydro-1H-3-benzazepin-2-amine.
| Compound Name | N,N-diethyl-6,7,8,9-tetrahydro-1H-3-benzazepin-2-amine |
|---|---|
| PubChem CID | 14147486 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N,N-diethyl-6,7,8,9-tetrahydro-1H-3-benzazepin-2-amine |
| SMILES | CCN(CC)C1=NC=CC2=C(CCCC2)C1 |
| InChI | InChI=1S/C14H22N2/c1-3-16(4-2)14-11-13-8-6-5-7-12(13)9-10-15-14/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | INVQGUGZQPNVRC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |