C26H54N4 — CID 141475935
N,N'-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)hexane-1,6-diamine (PubChem CID 141475935) has the molecular formula C26H54N4 and a molecular weight of 422.75 g/mol. Its IUPAC name is N,N'-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 141475935 |
| Molecular Formula | C26H54N4 |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 422.43 |
| IUPAC Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-3-yl)hexane-1,6-diamine |
| SMILES | CN1C(C)(C)CCC(NCCCCCCNC2CCC(C)(C)N(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C26H54N4/c1-23(2)17-15-21(25(5,6)29(23)9)27-19-13-11-12-14-20-28-22-16-18-24(3,4)30(10)26(22,7)8/h21-22,27-28H,11-20H2,1-10H3 |
| InChIKey | IGLSVGRSHBRXCJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|