About dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate
dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate (PubChem CID 141476637) has the molecular formula C10H9K2NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate.
Molecular Properties
| Compound Name | dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate |
| PubChem CID | 141476637 |
| Molecular Formula | C10H9K2NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate |
| SMILES | Nc1cc(CC(=O)[O-])ccc1CC(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C10H11NO4.2K/c11-8-3-6(4-9(12)13)1-2-7(8)5-10(14)15;;/h1-3H,4-5,11H2,(H,12,13)(H,14,15);;/q;2*+1/p-2 |
| InChIKey | PSOHWLOZQSZDQQ-UHFFFAOYSA-L |
| XLogP | -8.14 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | -8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate?
The IUPAC name of dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate (CID 141476637) is dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate.
What is the SMILES notation for dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate?
The canonical SMILES for dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate is Nc1cc(CC(=O)[O-])ccc1CC(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate?
The InChIKey is PSOHWLOZQSZDQQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H11NO4.2K/c11-8-3-6(4-9(12)13)1-2-7(8)5-10(14)15;;/h1-3H,4-5,11H2,(H,12,13)(H,14,15);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate?
dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate has a molecular weight of 285.38 g/mol, XLogP of -8.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-[3-amino-4-(carboxylatomethyl)phenyl]acetate is sourced from PubChem (CID 141476637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).