C15H22O — CID 141477428
(1S)-1,2,2,3,3,4-hexamethylinden-1-ol (PubChem CID 141477428) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1S)-1,2,2,3,3,4-hexamethylinden-1-ol.
| Compound Name | (1S)-1,2,2,3,3,4-hexamethylinden-1-ol |
|---|---|
| PubChem CID | 141477428 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S)-1,2,2,3,3,4-hexamethylinden-1-ol |
| SMILES | Cc1cccc2c1C(C)(C)C(C)(C)[C@]2(C)O |
| InChI | InChI=1S/C15H22O/c1-10-8-7-9-11-12(10)13(2,3)14(4,5)15(11,6)16/h7-9,16H,1-6H3/t15-/m1/s1 |
| InChIKey | FNFBFCNKBWWBGR-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |