C23H27N3O3 — CID 141479261
4-[6-(4-hydroxyphenyl)-2-imino-3-methyl-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol (PubChem CID 141479261) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-[6-(4-hydroxyphenyl)-2-imino-3-methyl-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol.
| Compound Name | 4-[6-(4-hydroxyphenyl)-2-imino-3-methyl-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol |
|---|---|
| PubChem CID | 141479261 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-[6-(4-hydroxyphenyl)-2-imino-3-methyl-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol |
| SMILES | [H]/N=C1\N=C(c2ccc(O)cc2)CC(c2cc(C(C)(C)C=C)c(O)cc2OC)N1C |
| InChI | InChI=1S/C23H27N3O3/c1-6-23(2,3)17-11-16(21(29-5)13-20(17)28)19-12-18(25-22(24)26(19)4)14-7-9-15(27)10-8-14/h6-11,13,19,24,27-28H,1,12H2,2-5H3/b24-22+ |
| InChIKey | OWKVJBAXFXHINF-ZNTNEXAZSA-N |
| XLogP | 4.37 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|