C28H28FN3O3 — CID 141479263
4-[3-(2-fluorophenyl)-6-(4-hydroxyphenyl)-2-imino-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol (PubChem CID 141479263) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)-6-(4-hydroxyphenyl)-2-imino-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol.
| Compound Name | 4-[3-(2-fluorophenyl)-6-(4-hydroxyphenyl)-2-imino-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol |
|---|---|
| PubChem CID | 141479263 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 4-[3-(2-fluorophenyl)-6-(4-hydroxyphenyl)-2-imino-4,5-dihydropyrimidin-4-yl]-5-methoxy-2-(2-methylbut-3-en-2-yl)phenol |
| SMILES | [H]/N=C1\N=C(c2ccc(O)cc2)CC(c2cc(C(C)(C)C=C)c(O)cc2OC)N1c1ccccc1F |
| InChI | InChI=1S/C28H28FN3O3/c1-5-28(2,3)20-14-19(26(35-4)16-25(20)34)24-15-22(17-10-12-18(33)13-11-17)31-27(30)32(24)23-9-7-6-8-21(23)29/h5-14,16,24,30,33-34H,1,15H2,2-4H3/b30-27+ |
| InChIKey | UURBJYGBCSQHFK-KDJFERLWSA-N |
| XLogP | 6.08 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|