C23H19ClN2O2 — CID 141480396
N-[1-[4-[(3-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-ylidene]hydroxylamine (PubChem CID 141480396) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-[1-[4-[(3-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-ylidene]hydroxylamine.
| Compound Name | N-[1-[4-[(3-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 141480396 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-[1-[4-[(3-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-ylidene]hydroxylamine |
| SMILES | ON=C(C=Cc1ccc(OCc2cccc(Cl)c2)cc1)C=Cc1ccccn1 |
| InChI | InChI=1S/C23H19ClN2O2/c24-20-5-3-4-19(16-20)17-28-23-13-8-18(9-14-23)7-10-22(26-27)12-11-21-6-1-2-15-25-21/h1-16,27H,17H2 |
| InChIKey | VUPVKVPCWRSVRB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|