C23H18ClNO2 — CID 141480414
1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-one (PubChem CID 141480414) has the molecular formula C23H18ClNO2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-one.
| Compound Name | 1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 141480414 |
| Molecular Formula | C23H18ClNO2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-[4-[(2-chlorophenyl)methoxy]phenyl]-5-pyridin-2-ylpenta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1ccc(OCc2ccccc2Cl)cc1)C=Cc1ccccn1 |
| InChI | InChI=1S/C23H18ClNO2/c24-23-7-2-1-5-19(23)17-27-22-14-9-18(10-15-22)8-12-21(26)13-11-20-6-3-4-16-25-20/h1-16H,17H2 |
| InChIKey | KFURVTWYYJKQCX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|