C23H17ClN2O2S2 — CID 108764615
(E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 108764615) has the molecular formula C23H17ClN2O2S2 and a molecular weight of 452.99 g/mol. Its IUPAC name is (E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108764615 |
| Molecular Formula | C23H17ClN2O2S2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2Cl)cc1)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C23H17ClN2O2S2/c24-19-5-2-1-4-17(19)14-28-18-10-7-16(8-11-18)9-12-22(27)26-23-25-20(15-30-23)21-6-3-13-29-21/h1-13,15H,14H2,(H,25,26,27)/b12-9+ |
| InChIKey | ZGLCYCAHRMRHJG-FMIVXFBMSA-N |
| XLogP | 6.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|