About 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate
1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate (PubChem CID 141480693) has the molecular formula C14H18FNO4
and a molecular weight of 283.30 g/mol. Its IUPAC name is 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate.
Molecular Properties
| Compound Name | 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate |
| PubChem CID | 141480693 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate |
| SMILES | COC(=O)C(C)(C)Nc1ccccc1C(=O)OC(C)F |
| InChI | InChI=1S/C14H18FNO4/c1-9(15)20-12(17)10-7-5-6-8-11(10)16-14(2,3)13(18)19-4/h5-9,16H,1-4H3 |
| InChIKey | FXWCDVKDLXVEOD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate?
The IUPAC name of 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate (CID 141480693) is 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate.
What is the SMILES notation for 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate?
The canonical SMILES for 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate is COC(=O)C(C)(C)Nc1ccccc1C(=O)OC(C)F.
What is the InChIKey of 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate?
The InChIKey is FXWCDVKDLXVEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO4/c1-9(15)20-12(17)10-7-5-6-8-11(10)16-14(2,3)13(18)19-4/h5-9,16H,1-4H3.
What are the key properties of 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate?
1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate has a molecular weight of 283.30 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethyl 2-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]benzoate is sourced from PubChem (CID 141480693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).