C16H23ClN2O6 — CID 141480955
2-O-tert-butyl 3-O-methyl 7-nitro-3,4,4a,5-tetrahydro-1H-isoquinoline-2,3-dicarboxylate;hydrochloride (PubChem CID 141480955) has the molecular formula C16H23ClN2O6 and a molecular weight of 374.82 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-methyl 7-nitro-3,4,4a,5-tetrahydro-1H-isoquinoline-2,3-dicarboxylate;hydrochloride.
| Compound Name | 2-O-tert-butyl 3-O-methyl 7-nitro-3,4,4a,5-tetrahydro-1H-isoquinoline-2,3-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 141480955 |
| Molecular Formula | C16H23ClN2O6 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-O-tert-butyl 3-O-methyl 7-nitro-3,4,4a,5-tetrahydro-1H-isoquinoline-2,3-dicarboxylate;hydrochloride |
| SMILES | COC(=O)C1CC2CC=C([N+](=O)[O-])C=C2CN1C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C16H22N2O6.ClH/c1-16(2,3)24-15(20)17-9-11-7-12(18(21)22)6-5-10(11)8-13(17)14(19)23-4;/h6-7,10,13H,5,8-9H2,1-4H3;1H |
| InChIKey | XEBDBJQTJYIJKX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|