C25H15N5 — CID 141483083
4-[2,5-bis(4-cyanophenyl)-1-methylimidazol-4-yl]benzonitrile (PubChem CID 141483083) has the molecular formula C25H15N5 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-[2,5-bis(4-cyanophenyl)-1-methylimidazol-4-yl]benzonitrile.
| Compound Name | 4-[2,5-bis(4-cyanophenyl)-1-methylimidazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 141483083 |
| Molecular Formula | C25H15N5 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[2,5-bis(4-cyanophenyl)-1-methylimidazol-4-yl]benzonitrile |
| SMILES | Cn1c(-c2ccc(C#N)cc2)nc(-c2ccc(C#N)cc2)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H15N5/c1-30-24(21-10-4-18(15-27)5-11-21)23(20-8-2-17(14-26)3-9-20)29-25(30)22-12-6-19(16-28)7-13-22/h2-13H,1H3 |
| InChIKey | ZHYKFIOMOPBLQK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |