C22H22FN5O — CID 141484612
N-ethyl-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-2-(triazol-2-yl)benzamide (PubChem CID 141484612) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is N-ethyl-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-2-(triazol-2-yl)benzamide.
| Compound Name | N-ethyl-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-2-(triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 141484612 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-ethyl-N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-2-(triazol-2-yl)benzamide |
| SMILES | CCN(CCc1c[nH]c2cc(F)ccc12)C(=O)c1cc(C)ccc1-n1nccn1 |
| InChI | InChI=1S/C22H22FN5O/c1-3-27(11-8-16-14-24-20-13-17(23)5-6-18(16)20)22(29)19-12-15(2)4-7-21(19)28-25-9-10-26-28/h4-7,9-10,12-14,24H,3,8,11H2,1-2H3 |
| InChIKey | ZDHCFXQSCXPDDW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |