C27H28F3N5O4S — CID 141484668
ethyl 4-[4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate (PubChem CID 141484668) has the molecular formula C27H28F3N5O4S and a molecular weight of 575.61 g/mol. Its IUPAC name is ethyl 4-[4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141484668 |
| Molecular Formula | C27H28F3N5O4S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | ethyl 4-[4-[7-[6-cyano-5-(trifluoromethyl)-3-pyridinyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Oc2ccc(N3C(S)N(c4cnc(C#N)c(C(F)(F)F)c4)C(=O)C34CCC4)cc2)CC1 |
| InChI | InChI=1S/C27H28F3N5O4S/c1-2-38-25(37)33-12-8-20(9-13-33)39-19-6-4-17(5-7-19)35-24(40)34(23(36)26(35)10-3-11-26)18-14-21(27(28,29)30)22(15-31)32-16-18/h4-7,14,16,20,24,40H,2-3,8-13H2,1H3 |
| InChIKey | FOKIHEWSURJKQD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|