C27H27F4N5O2S — CID 162606005
5-[5-[4-[(4-fluoro-4-prop-1-en-2-ylpyrrolidin-2-yl)methoxy]phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 162606005) has the molecular formula C27H27F4N5O2S and a molecular weight of 561.61 g/mol. Its IUPAC name is 5-[5-[4-[(4-fluoro-4-prop-1-en-2-ylpyrrolidin-2-yl)methoxy]phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[5-[4-[(4-fluoro-4-prop-1-en-2-ylpyrrolidin-2-yl)methoxy]phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 162606005 |
| Molecular Formula | C27H27F4N5O2S |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 5-[5-[4-[(4-fluoro-4-prop-1-en-2-ylpyrrolidin-2-yl)methoxy]phenyl]-8-oxo-6-sulfanyl-5,7-diazaspiro[3.4]octan-7-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | C=C(C)C1(F)CNC(COc2ccc(N3C(S)N(c4cnc(C#N)c(C(F)(F)F)c4)C(=O)C34CCC4)cc2)C1 |
| InChI | InChI=1S/C27H27F4N5O2S/c1-16(2)25(28)11-17(34-15-25)14-38-20-6-4-18(5-7-20)36-24(39)35(23(37)26(36)8-3-9-26)19-10-21(27(29,30)31)22(12-32)33-13-19/h4-7,10,13,17,24,34,39H,1,3,8-9,11,14-15H2,2H3 |
| InChIKey | XSTHFCLDKGIKIP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|