About 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride
2,2-dimethyl-1,3-thiazole-3-carbonyl chloride (PubChem CID 141486503) has the molecular formula C6H8ClNOS
and a molecular weight of 177.66 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride |
| PubChem CID | 141486503 |
| Molecular Formula | C6H8ClNOS |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride |
| SMILES | CC1(C)SC=CN1C(=O)Cl |
| InChI | InChI=1S/C6H8ClNOS/c1-6(2)8(5(7)9)3-4-10-6/h3-4H,1-2H3 |
| InChIKey | ARGWNJJUALQHFB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride?
The IUPAC name of 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride (CID 141486503) is 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride.
What is the SMILES notation for 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride?
The canonical SMILES for 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride is CC1(C)SC=CN1C(=O)Cl.
What is the InChIKey of 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride?
The InChIKey is ARGWNJJUALQHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNOS/c1-6(2)8(5(7)9)3-4-10-6/h3-4H,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride?
2,2-dimethyl-1,3-thiazole-3-carbonyl chloride has a molecular weight of 177.66 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-thiazole-3-carbonyl chloride is sourced from PubChem (CID 141486503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).