C6H9NOS2 — CID 115749773
3-(2-methylsulfanylethyl)-1,3-thiazol-2-one (PubChem CID 115749773) has the molecular formula C6H9NOS2 and a molecular weight of 175.28 g/mol. Its IUPAC name is 3-(2-methylsulfanylethyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-methylsulfanylethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115749773 |
| Molecular Formula | C6H9NOS2 |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | 3-(2-methylsulfanylethyl)-1,3-thiazol-2-one |
| SMILES | CSCCn1ccsc1=O |
| InChI | InChI=1S/C6H9NOS2/c1-9-4-2-7-3-5-10-6(7)8/h3,5H,2,4H2,1H3 |
| InChIKey | JUZLQURLEPGPHF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |