About ethane;3-methyl-1,3-thiazol-2-one
ethane;3-methyl-1,3-thiazol-2-one (PubChem CID 91228224) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is ethane;3-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | ethane;3-methyl-1,3-thiazol-2-one |
| PubChem CID | 91228224 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | ethane;3-methyl-1,3-thiazol-2-one |
| SMILES | CC.Cn1ccsc1=O |
| InChI | InChI=1S/C4H5NOS.C2H6/c1-5-2-3-7-4(5)6;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | PYHOLNXUAULVMS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1,3-thiazol-2-one?
The IUPAC name of ethane;3-methyl-1,3-thiazol-2-one (CID 91228224) is ethane;3-methyl-1,3-thiazol-2-one.
What is the SMILES notation for ethane;3-methyl-1,3-thiazol-2-one?
The canonical SMILES for ethane;3-methyl-1,3-thiazol-2-one is CC.Cn1ccsc1=O.
What is the InChIKey of ethane;3-methyl-1,3-thiazol-2-one?
The InChIKey is PYHOLNXUAULVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NOS.C2H6/c1-5-2-3-7-4(5)6;1-2/h2-3H,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1,3-thiazol-2-one?
ethane;3-methyl-1,3-thiazol-2-one has a molecular weight of 145.23 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 91228224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).