C7H10FNOS — CID 126994849
3-(2-fluorobutyl)-1,3-thiazol-2-one (PubChem CID 126994849) has the molecular formula C7H10FNOS and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-(2-fluorobutyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-fluorobutyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 126994849 |
| Molecular Formula | C7H10FNOS |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 3-(2-fluorobutyl)-1,3-thiazol-2-one |
| SMILES | CCC(F)Cn1ccsc1=O |
| InChI | InChI=1S/C7H10FNOS/c1-2-6(8)5-9-3-4-11-7(9)10/h3-4,6H,2,5H2,1H3 |
| InChIKey | AXCULFDNIMLRTA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |