C24H28ClF2N5O — CID 141487767
5-chloro-2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]pyrimidine (PubChem CID 141487767) has the molecular formula C24H28ClF2N5O and a molecular weight of 475.97 g/mol. Its IUPAC name is 5-chloro-2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 141487767 |
| Molecular Formula | C24H28ClF2N5O |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 5-chloro-2-[4-[3-[3,5-difluoro-4-(5-propan-2-yl-1H-pyrazol-3-yl)phenoxy]propyl]piperidin-1-yl]pyrimidine |
| SMILES | CC(C)c1cc(-c2c(F)cc(OCCCC3CCN(c4ncc(Cl)cn4)CC3)cc2F)n[nH]1 |
| InChI | InChI=1S/C24H28ClF2N5O/c1-15(2)21-12-22(31-30-21)23-19(26)10-18(11-20(23)27)33-9-3-4-16-5-7-32(8-6-16)24-28-13-17(25)14-29-24/h10-16H,3-9H2,1-2H3,(H,30,31) |
| InChIKey | FGWXYFDIQUZMCV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|