About methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate
methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate (PubChem CID 141490537) has the molecular formula C12H9FN2O2
and a molecular weight of 232.21 g/mol. Its IUPAC name is methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate.
Analyze methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate?
The IUPAC name of methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate (CID 141490537) is methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate.
What is the SMILES notation for methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate?
The canonical SMILES for methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate is COC(=O)c1cc2c([nH]1)[nH]c1ccc(F)cc12.
What is the InChIKey of methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate?
The InChIKey is CDDWXXNLPDIIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O2/c1-17-12(16)10-5-8-7-4-6(13)2-3-9(7)14-11(8)15-10/h2-5,14-15H,1H3.
What are the key properties of methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate?
methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate has a molecular weight of 232.21 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-fluoro-3,4-dihydropyrrolo[2,3-b]indole-2-carboxylate is sourced from PubChem (CID 141490537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).