C25H27FN4O2 — CID 141491058
tert-butyl N-[1-[4-(6-amino-4-phenylpyridazin-3-yl)phenyl]-3-fluorocyclobutyl]carbamate (PubChem CID 141491058) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(6-amino-4-phenylpyridazin-3-yl)phenyl]-3-fluorocyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(6-amino-4-phenylpyridazin-3-yl)phenyl]-3-fluorocyclobutyl]carbamate |
|---|---|
| PubChem CID | 141491058 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | tert-butyl N-[1-[4-(6-amino-4-phenylpyridazin-3-yl)phenyl]-3-fluorocyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3nnc(N)cc3-c3ccccc3)cc2)CC(F)C1 |
| InChI | InChI=1S/C25H27FN4O2/c1-24(2,3)32-23(31)28-25(14-19(26)15-25)18-11-9-17(10-12-18)22-20(13-21(27)29-30-22)16-7-5-4-6-8-16/h4-13,19H,14-15H2,1-3H3,(H2,27,29)(H,28,31) |
| InChIKey | QUXFXPQSYNHECO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |