About 4-ethynylphthalaldehyde
4-ethynylphthalaldehyde (PubChem CID 141496922) has the molecular formula C10H6O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-ethynylphthalaldehyde.
Molecular Properties
| Compound Name | 4-ethynylphthalaldehyde |
| PubChem CID | 141496922 |
| Molecular Formula | C10H6O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 4-ethynylphthalaldehyde |
| SMILES | C#Cc1ccc(C=O)c(C=O)c1 |
| InChI | InChI=1S/C10H6O2/c1-2-8-3-4-9(6-11)10(5-8)7-12/h1,3-7H |
| InChIKey | CWLMBLBKNFOJPK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynylphthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynylphthalaldehyde?
The IUPAC name of 4-ethynylphthalaldehyde (CID 141496922) is 4-ethynylphthalaldehyde.
What is the SMILES notation for 4-ethynylphthalaldehyde?
The canonical SMILES for 4-ethynylphthalaldehyde is C#Cc1ccc(C=O)c(C=O)c1.
What is the InChIKey of 4-ethynylphthalaldehyde?
The InChIKey is CWLMBLBKNFOJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2/c1-2-8-3-4-9(6-11)10(5-8)7-12/h1,3-7H.
What are the key properties of 4-ethynylphthalaldehyde?
4-ethynylphthalaldehyde has a molecular weight of 158.16 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynylphthalaldehyde is sourced from PubChem (CID 141496922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).