C18H23N3O4S — CID 141497092
methyl (2'S,3S)-1'-(tert-butylsulfanylcarbamoyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 141497092) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is methyl (2'S,3S)-1'-(tert-butylsulfanylcarbamoyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | methyl (2'S,3S)-1'-(tert-butylsulfanylcarbamoyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 141497092 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl (2'S,3S)-1'-(tert-butylsulfanylcarbamoyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(CN1C(=O)NSC(C)(C)C)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H23N3O4S/c1-17(2,3)26-20-16(24)21-10-18(9-13(21)14(22)25-4)11-7-5-6-8-12(11)19-15(18)23/h5-8,13H,9-10H2,1-4H3,(H,19,23)(H,20,24)/t13-,18+/m0/s1 |
| InChIKey | DFQZYNAFEMXZFH-SCLBCKFNSA-N |
| XLogP | 2.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|