C25H31N5O5 — CID 168892741
tert-butyl N-[4-[[2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-oxoacetyl]amino]cyclohexyl]carbamate (PubChem CID 168892741) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-oxoacetyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-oxoacetyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 168892741 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | tert-butyl N-[4-[[2-[(3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-oxoacetyl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NC(=O)C(=O)N2C[C@]3(CC2C#N)C(=O)Nc2ccccc23)CC1 |
| InChI | InChI=1S/C25H31N5O5/c1-24(2,3)35-23(34)28-16-10-8-15(9-11-16)27-20(31)21(32)30-14-25(12-17(30)13-26)18-6-4-5-7-19(18)29-22(25)33/h4-7,15-17H,8-12,14H2,1-3H3,(H,27,31)(H,28,34)(H,29,33)/t15?,16?,17?,25-/m0/s1 |
| InChIKey | AKTWVCMSABZAPF-AFKNUFNFSA-N |
| XLogP | 1.95 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|