C32H37FN4O5 — CID 169489772
tert-butyl N-[(3S,6R)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]carbamate (PubChem CID 169489772) has the molecular formula C32H37FN4O5 and a molecular weight of 576.67 g/mol. Its IUPAC name is tert-butyl N-[(3S,6R)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6R)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 169489772 |
| Molecular Formula | C32H37FN4O5 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | tert-butyl N-[(3S,6R)-7-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-6-[(4-fluorophenyl)methyl]-2-methyl-4,7-dioxoheptan-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)C[C@@H](Cc1ccc(F)cc1)C(=O)N1C[C@]2(C[C@H]1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C32H37FN4O5/c1-19(2)27(36-30(41)42-31(3,4)5)26(38)15-21(14-20-10-12-22(33)13-11-20)28(39)37-18-32(16-23(37)17-34)24-8-6-7-9-25(24)35-29(32)40/h6-13,19,21,23,27H,14-16,18H2,1-5H3,(H,35,40)(H,36,41)/t21-,23+,27+,32+/m1/s1 |
| InChIKey | RERGSTKOGPHVBB-WJIAHMBVSA-N |
| XLogP | 4.51 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |