C24H30F3N5O4 — CID 167446195
(2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-2-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propanamide (PubChem CID 167446195) has the molecular formula C24H30F3N5O4 and a molecular weight of 509.53 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-2-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propanamide.
| Compound Name | (2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-2-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propanamide |
|---|---|
| PubChem CID | 167446195 |
| Molecular Formula | C24H30F3N5O4 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-2-[(2,2,2-trifluoro-1-hydroxyethyl)amino]propanamide |
| SMILES | C[C@H](NC(O)C(F)(F)F)C(=O)N[C@@H](CC(C)(C)C)C(=O)N1C[C@]2(C[C@H]1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H30F3N5O4/c1-13(29-21(36)24(25,26)27)18(33)30-17(10-22(2,3)4)19(34)32-12-23(9-14(32)11-28)15-7-5-6-8-16(15)31-20(23)35/h5-8,13-14,17,21,29,36H,9-10,12H2,1-4H3,(H,30,33)(H,31,35)/t13-,14-,17-,21?,23-/m0/s1 |
| InChIKey | MHWPEALGVMNDJQ-HIQSTIIFSA-N |
| XLogP | 1.78 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|