C29H27F6N5O4 — CID 166488007
N-[2,4-bis(trifluoromethyl)phenyl]-N'-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]oxamide (PubChem CID 166488007) has the molecular formula C29H27F6N5O4 and a molecular weight of 623.55 g/mol. Its IUPAC name is N-[2,4-bis(trifluoromethyl)phenyl]-N'-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]oxamide.
| Compound Name | N-[2,4-bis(trifluoromethyl)phenyl]-N'-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]oxamide |
|---|---|
| PubChem CID | 166488007 |
| Molecular Formula | C29H27F6N5O4 |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | N-[2,4-bis(trifluoromethyl)phenyl]-N'-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]oxamide |
| SMILES | CC(C)(C)C[C@H](NC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1C(F)(F)F)C(=O)N1C[C@]2(C[C@H]1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H27F6N5O4/c1-26(2,3)12-21(24(43)40-14-27(11-16(40)13-36)17-6-4-5-7-19(17)39-25(27)44)38-23(42)22(41)37-20-9-8-15(28(30,31)32)10-18(20)29(33,34)35/h4-10,16,21H,11-12,14H2,1-3H3,(H,37,41)(H,38,42)(H,39,44)/t16-,21-,27-/m0/s1 |
| InChIKey | ZBDHURSHCHUEEE-PQXCKQOFSA-N |
| XLogP | 4.60 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|