C35H35F2N3O5 — CID 169232052
2,6-difluoro-N-[(3S,6R)-7-[(2'S,3R)-2'-formyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-6-[(4-methylphenyl)methyl]-4,7-dioxoheptan-3-yl]benzamide (PubChem CID 169232052) has the molecular formula C35H35F2N3O5 and a molecular weight of 615.68 g/mol. Its IUPAC name is 2,6-difluoro-N-[(3S,6R)-7-[(2'S,3R)-2'-formyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-6-[(4-methylphenyl)methyl]-4,7-dioxoheptan-3-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[(3S,6R)-7-[(2'S,3R)-2'-formyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-6-[(4-methylphenyl)methyl]-4,7-dioxoheptan-3-yl]benzamide |
|---|---|
| PubChem CID | 169232052 |
| Molecular Formula | C35H35F2N3O5 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 2,6-difluoro-N-[(3S,6R)-7-[(2'S,3R)-2'-formyl-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-6-[(4-methylphenyl)methyl]-4,7-dioxoheptan-3-yl]benzamide |
| SMILES | Cc1ccc(C[C@H](CC(=O)[C@@H](NC(=O)c2c(F)cccc2F)C(C)C)C(=O)N2C[C@]3(C[C@H]2C=O)C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C35H35F2N3O5/c1-20(2)31(39-32(43)30-26(36)8-6-9-27(30)37)29(42)16-23(15-22-13-11-21(3)12-14-22)33(44)40-19-35(17-24(40)18-41)25-7-4-5-10-28(25)38-34(35)45/h4-14,18,20,23-24,31H,15-17,19H2,1-3H3,(H,38,45)(H,39,43)/t23-,24+,31+,35+/m1/s1 |
| InChIKey | FNWBZXGPNKXMDK-VHCVIXOMSA-N |
| XLogP | 4.54 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|