C17H25ClN2O4 — CID 141497195
ethyl 2-(4-acetyl-2-methoxyphenyl)-4-methylpiperazine-1-carboxylate;hydrochloride (PubChem CID 141497195) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is ethyl 2-(4-acetyl-2-methoxyphenyl)-4-methylpiperazine-1-carboxylate;hydrochloride.
| Compound Name | ethyl 2-(4-acetyl-2-methoxyphenyl)-4-methylpiperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 141497195 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 2-(4-acetyl-2-methoxyphenyl)-4-methylpiperazine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)N1CCN(C)CC1c1ccc(C(C)=O)cc1OC.Cl |
| InChI | InChI=1S/C17H24N2O4.ClH/c1-5-23-17(21)19-9-8-18(3)11-15(19)14-7-6-13(12(2)20)10-16(14)22-4;/h6-7,10,15H,5,8-9,11H2,1-4H3;1H |
| InChIKey | LLVQXWOKAZINHF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |