C25H31NO6 — CID 164586237
benzyl (2S)-4-ethoxy-2-(4-ethoxycarbonyl-2-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 164586237) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is benzyl (2S)-4-ethoxy-2-(4-ethoxycarbonyl-2-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2S)-4-ethoxy-2-(4-ethoxycarbonyl-2-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164586237 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | benzyl (2S)-4-ethoxy-2-(4-ethoxycarbonyl-2-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc([C@@H]2CC(OCC)CCN2C(=O)OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C25H31NO6/c1-4-30-20-13-14-26(25(28)32-17-18-9-7-6-8-10-18)22(16-20)21-12-11-19(15-23(21)29-3)24(27)31-5-2/h6-12,15,20,22H,4-5,13-14,16-17H2,1-3H3/t20?,22-/m0/s1 |
| InChIKey | PWPKSIGEXTZKAV-IAXKEJLGSA-N |
| XLogP | 4.75 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |