C28H35NO7 — CID 164586218
benzyl (2S,4S)-2-(4-methoxycarbonylphenyl)-4-[2-(oxan-2-yloxy)ethoxy]piperidine-1-carboxylate (PubChem CID 164586218) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is benzyl (2S,4S)-2-(4-methoxycarbonylphenyl)-4-[2-(oxan-2-yloxy)ethoxy]piperidine-1-carboxylate.
| Compound Name | benzyl (2S,4S)-2-(4-methoxycarbonylphenyl)-4-[2-(oxan-2-yloxy)ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164586218 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | benzyl (2S,4S)-2-(4-methoxycarbonylphenyl)-4-[2-(oxan-2-yloxy)ethoxy]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H]2C[C@@H](OCCOC3CCCCO3)CCN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35NO7/c1-32-27(30)23-12-10-22(11-13-23)25-19-24(33-17-18-35-26-9-5-6-16-34-26)14-15-29(25)28(31)36-20-21-7-3-2-4-8-21/h2-4,7-8,10-13,24-26H,5-6,9,14-20H2,1H3/t24-,25-,26?/m0/s1 |
| InChIKey | HFHAWCNTISBCOO-NPGWBMRXSA-N |
| XLogP | 4.88 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|