C11H6ClF7O3S — CID 141497498
1-(3-chloro-2-fluorophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)but-2-ene-2-sulfonic acid (PubChem CID 141497498) has the molecular formula C11H6ClF7O3S and a molecular weight of 386.67 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)but-2-ene-2-sulfonic acid.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)but-2-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 141497498 |
| Molecular Formula | C11H6ClF7O3S |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)but-2-ene-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(Cc1cccc(Cl)c1F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6ClF7O3S/c12-6-3-1-2-5(8(6)13)4-7(23(20,21)22)9(10(14,15)16)11(17,18)19/h1-3H,4H2,(H,20,21,22) |
| InChIKey | VSQXRSBIHUAKFM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|