C19H19BrF3NO4S — CID 141497804
ethyl 3-bromo-2-[(4-methylphenyl)sulfonylamino]-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 141497804) has the molecular formula C19H19BrF3NO4S and a molecular weight of 494.33 g/mol. Its IUPAC name is ethyl 3-bromo-2-[(4-methylphenyl)sulfonylamino]-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 3-bromo-2-[(4-methylphenyl)sulfonylamino]-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 141497804 |
| Molecular Formula | C19H19BrF3NO4S |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | ethyl 3-bromo-2-[(4-methylphenyl)sulfonylamino]-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)C(Br)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19BrF3NO4S/c1-3-28-18(25)17(24-29(26,27)15-10-4-12(2)5-11-15)16(20)13-6-8-14(9-7-13)19(21,22)23/h4-11,16-17,24H,3H2,1-2H3 |
| InChIKey | HYGAAITVNBMTRX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|