About (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium
(2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium (PubChem CID 141498286) has the molecular formula C21H32N4O2
and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium.
Molecular Properties
| Compound Name | (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium |
| PubChem CID | 141498286 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.[N-]=[N+]=N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C12H23N.C9H9N3O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;10-12-11-8(9(13)14)6-7-4-2-1-3-5-7/h11-13H,1-10H2;1-5,8H,6H2,(H,13,14)/t;8-/m.0/s1 |
| InChIKey | AKAIZEHUGUEJRK-WDBKTSHHSA-N |
| XLogP | 2.87 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium?
The IUPAC name of (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium (CID 141498286) is (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium.
What is the SMILES notation for (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium?
The canonical SMILES for (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium is C1CCC([NH2+]C2CCCCC2)CC1.[N-]=[N+]=N[C@@H](Cc1ccccc1)C(=O)[O-].
What is the InChIKey of (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium?
The InChIKey is AKAIZEHUGUEJRK-WDBKTSHHSA-N. The full InChI is InChI=1S/C12H23N.C9H9N3O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;10-12-11-8(9(13)14)6-7-4-2-1-3-5-7/h11-13H,1-10H2;1-5,8H,6H2,(H,13,14)/t;8-/m.0/s1.
What are the key properties of (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium?
(2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium has a molecular weight of 372.51 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-azido-3-phenylpropanoate;dicyclohexylazanium is sourced from PubChem (CID 141498286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).