C26H40N2O6 — CID 53487170
dicyclohexylazanium;(4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 53487170) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is dicyclohexylazanium;(4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | dicyclohexylazanium;(4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 53487170 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | dicyclohexylazanium;(4S)-5-methoxy-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.COC(=O)[C@H](CCC(=O)[O-])NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO6.C12H23N/c1-20-13(18)11(7-8-12(16)17)15-14(19)21-9-10-5-3-2-4-6-10;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h2-6,11H,7-9H2,1H3,(H,15,19)(H,16,17);11-13H,1-10H2/t11-;/m0./s1 |
| InChIKey | BRRFRNXPAYUOHB-MERQFXBCSA-N |
| XLogP | 2.20 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |