C14H20O9S — CID 141499151
[2-methyl-3-prop-2-enoyloxy-2-(1-prop-2-enoyloxyethyl)butanoyl]oxymethanesulfonic acid (PubChem CID 141499151) has the molecular formula C14H20O9S and a molecular weight of 364.37 g/mol. Its IUPAC name is [2-methyl-3-prop-2-enoyloxy-2-(1-prop-2-enoyloxyethyl)butanoyl]oxymethanesulfonic acid.
| Compound Name | [2-methyl-3-prop-2-enoyloxy-2-(1-prop-2-enoyloxyethyl)butanoyl]oxymethanesulfonic acid |
|---|---|
| PubChem CID | 141499151 |
| Molecular Formula | C14H20O9S |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [2-methyl-3-prop-2-enoyloxy-2-(1-prop-2-enoyloxyethyl)butanoyl]oxymethanesulfonic acid |
| SMILES | C=CC(=O)OC(C)C(C)(C(=O)OCS(=O)(=O)O)C(C)OC(=O)C=C |
| InChI | InChI=1S/C14H20O9S/c1-6-11(15)22-9(3)14(5,10(4)23-12(16)7-2)13(17)21-8-24(18,19)20/h6-7,9-10H,1-2,8H2,3-5H3,(H,18,19,20) |
| InChIKey | XROCUKSYFYWBIX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|