C14H14N6O5S — CID 14155332
5-methoxy-6-methyl-N-(2-methyl-6-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide (PubChem CID 14155332) has the molecular formula C14H14N6O5S and a molecular weight of 378.37 g/mol. Its IUPAC name is 5-methoxy-6-methyl-N-(2-methyl-6-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide.
| Compound Name | 5-methoxy-6-methyl-N-(2-methyl-6-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 14155332 |
| Molecular Formula | C14H14N6O5S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-methoxy-6-methyl-N-(2-methyl-6-nitrophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
| SMILES | COc1nc2nc(S(=O)(=O)Nc3c(C)cccc3[N+](=O)[O-])nn2cc1C |
| InChI | InChI=1S/C14H14N6O5S/c1-8-5-4-6-10(20(21)22)11(8)18-26(23,24)14-16-13-15-12(25-3)9(2)7-19(13)17-14/h4-7,18H,1-3H3 |
| InChIKey | CGVVSGGSQRADQB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|