C16H14F3N5O5S — CID 21464339
7-methyl-N-(2-methyl-6-nitrophenyl)-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide (PubChem CID 21464339) has the molecular formula C16H14F3N5O5S and a molecular weight of 445.38 g/mol. Its IUPAC name is 7-methyl-N-(2-methyl-6-nitrophenyl)-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide.
| Compound Name | 7-methyl-N-(2-methyl-6-nitrophenyl)-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 21464339 |
| Molecular Formula | C16H14F3N5O5S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 7-methyl-N-(2-methyl-6-nitrophenyl)-5-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide |
| SMILES | Cc1cc(OCC(F)(F)F)n2nc(S(=O)(=O)Nc3c(C)cccc3[N+](=O)[O-])nc2c1 |
| InChI | InChI=1S/C16H14F3N5O5S/c1-9-6-12-20-15(21-23(12)13(7-9)29-8-16(17,18)19)30(27,28)22-14-10(2)4-3-5-11(14)24(25)26/h3-7,22H,8H2,1-2H3 |
| InChIKey | QHPWUVQCLARMBO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|