C14H14FN5O3S — CID 21464388
N-(2-fluoro-5-methyl-3-pyridinyl)-5-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide (PubChem CID 21464388) has the molecular formula C14H14FN5O3S and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(2-fluoro-5-methyl-3-pyridinyl)-5-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide.
| Compound Name | N-(2-fluoro-5-methyl-3-pyridinyl)-5-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 21464388 |
| Molecular Formula | C14H14FN5O3S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(2-fluoro-5-methyl-3-pyridinyl)-5-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide |
| SMILES | COc1cc(C)cc2nc(S(=O)(=O)Nc3cc(C)cnc3F)nn12 |
| InChI | InChI=1S/C14H14FN5O3S/c1-8-5-11-17-14(18-20(11)12(6-8)23-3)24(21,22)19-10-4-9(2)7-16-13(10)15/h4-7,19H,1-3H3 |
| InChIKey | GMYQGTLXXXHLFX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|