C22H31N3O5 — CID 14155492
N-methyl-2-(3-nitrophenoxy)-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide (PubChem CID 14155492) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-methyl-2-(3-nitrophenoxy)-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide.
| Compound Name | N-methyl-2-(3-nitrophenoxy)-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide |
|---|---|
| PubChem CID | 14155492 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-methyl-2-(3-nitrophenoxy)-N-[(5S,7R,8R)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide |
| SMILES | CN(C(=O)COc1cccc([N+](=O)[O-])c1)[C@@H]1CC[C@]2(CCCO2)C[C@H]1N1CCCC1 |
| InChI | InChI=1S/C22H31N3O5/c1-23(21(26)16-29-18-7-4-6-17(14-18)25(27)28)19-8-10-22(9-5-13-30-22)15-20(19)24-11-2-3-12-24/h4,6-7,14,19-20H,2-3,5,8-13,15-16H2,1H3/t19-,20-,22-/m1/s1 |
| InChIKey | RKZZSBJQERARGS-KCZVDYSFSA-N |
| XLogP | 3.00 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|