C14H16O7 — CID 14160575
4-(4-hydroxyphenyl)-5-(2,3,4-trihydroxyoxolan-2-yl)oxolan-2-one (PubChem CID 14160575) has the molecular formula C14H16O7 and a molecular weight of 296.27 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-5-(2,3,4-trihydroxyoxolan-2-yl)oxolan-2-one.
| Compound Name | 4-(4-hydroxyphenyl)-5-(2,3,4-trihydroxyoxolan-2-yl)oxolan-2-one |
|---|---|
| PubChem CID | 14160575 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-(4-hydroxyphenyl)-5-(2,3,4-trihydroxyoxolan-2-yl)oxolan-2-one |
| SMILES | O=C1CC(c2ccc(O)cc2)C(C2(O)OCC(O)C2O)O1 |
| InChI | InChI=1S/C14H16O7/c15-8-3-1-7(2-4-8)9-5-11(17)21-13(9)14(19)12(18)10(16)6-20-14/h1-4,9-10,12-13,15-16,18-19H,5-6H2 |
| InChIKey | VFVLKVMYKSHKCF-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |