C30H38O6 — CID 14164864
5-hydroxy-4-[6-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]-3,4-dioxocyclohexa-1,5-dien-1-yl]-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 14164864) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 5-hydroxy-4-[6-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]-3,4-dioxocyclohexa-1,5-dien-1-yl]-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 5-hydroxy-4-[6-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]-3,4-dioxocyclohexa-1,5-dien-1-yl]-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 14164864 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 5-hydroxy-4-[6-hydroxy-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]-3,4-dioxocyclohexa-1,5-dien-1-yl]-3-methyl-6-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(C)=CCC[C@H](C)C1=C(O)C(C2=C(C)C(=O)C(=O)C([C@@H](C)CCC=C(C)C)=C2O)=C(C)C(=O)C1=O |
| InChI | InChI=1S/C30H38O6/c1-15(2)11-9-13-17(5)21-27(33)23(19(7)25(31)29(21)35)24-20(8)26(32)30(36)22(28(24)34)18(6)14-10-12-16(3)4/h11-12,17-18,33-34H,9-10,13-14H2,1-8H3/t17-,18-/m0/s1 |
| InChIKey | NBYURTVEIQMHJD-ROUUACIJSA-N |
| XLogP | 6.31 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|