C26H20N2O4S2 — CID 1416921
(5E)-5-[(2-methoxyphenyl)methylidene]-3-(3-oxo-3-phenothiazin-10-ylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 1416921) has the molecular formula C26H20N2O4S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is (5E)-5-[(2-methoxyphenyl)methylidene]-3-(3-oxo-3-phenothiazin-10-ylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-methoxyphenyl)methylidene]-3-(3-oxo-3-phenothiazin-10-ylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1416921 |
| Molecular Formula | C26H20N2O4S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | (5E)-5-[(2-methoxyphenyl)methylidene]-3-(3-oxo-3-phenothiazin-10-ylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccccc1/C=C1/SC(=O)N(CCC(=O)N2c3ccccc3Sc3ccccc32)C1=O |
| InChI | InChI=1S/C26H20N2O4S2/c1-32-20-11-5-2-8-17(20)16-23-25(30)27(26(31)34-23)15-14-24(29)28-18-9-3-6-12-21(18)33-22-13-7-4-10-19(22)28/h2-13,16H,14-15H2,1H3/b23-16+ |
| InChIKey | SLIZOMLMUAILRB-XQNSMLJCSA-N |
| XLogP | 5.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|